![5-Dimethoxymethyl-1H-pyrrolo[2,3-b]pyridine (CAS: 913983-17-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678181.png "5-Dimethoxymethyl-1H-pyrrolo[2,3-b]pyridine chemical structure")
5-Dimethoxymethyl-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0678181
CAS No: 913983-17-2
- Chemical Name: 5-Dimethoxymethyl-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C10H12N2O2
- Molecular Weight: 192.21
- InChI Key: ACLBNCNOVBNVSE-UHFFFAOYSA-N
- InChI: InChI=1S/C10H12N2O2/c1-13-10(14-2)8-5-7-3-4-11-9(7)12-6-8/h3-6,10H,1-2H3,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 192.21400 |
| Density: | 1.217g/cm3 |
| CAS: | 913983-17-2 |
| Bolling_Point: | N/A |
| Product_Name: | 5-(dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine |
| Melting_Point: | 119-120ºC |
| Flash_Point: | N/A |
| MF: | C10H12N2O2 |
| Melting_Point: | 119-120ºC |
|---|---|
| Density: | 1.217g/cm3 |
| LogP: | 1.85430 |
| Refractive_Index: | 1.603 |
| FW: | 192.21400 |
| PSA: | 47.14000 |
| MF: | C10H12N2O2 |
| Exact_Mass: | 192.09000 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)